C14H29NO3 — CID 154643004
N-[2-(2-heptoxyethoxy)ethyl]propanamide (PubChem CID 154643004) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is N-[2-(2-heptoxyethoxy)ethyl]propanamide.
| Compound Name | N-[2-(2-heptoxyethoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 154643004 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | N-[2-(2-heptoxyethoxy)ethyl]propanamide |
| SMILES | CCCCCCCOCCOCCNC(=O)CC |
| InChI | InChI=1S/C14H29NO3/c1-3-5-6-7-8-10-17-12-13-18-11-9-15-14(16)4-2/h3-13H2,1-2H3,(H,15,16) |
| InChIKey | BRJMINFKVMQWIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|