C23H50N4O6 — CID 171093333
4-aminobutanamide;11-[[2-(2-ethoxyethoxy)acetyl]amino]undecanoic acid;N-methylmethanamine (PubChem CID 171093333) has the molecular formula C23H50N4O6 and a molecular weight of 478.68 g/mol. Its IUPAC name is 4-aminobutanamide;11-[[2-(2-ethoxyethoxy)acetyl]amino]undecanoic acid;N-methylmethanamine.
| Compound Name | 4-aminobutanamide;11-[[2-(2-ethoxyethoxy)acetyl]amino]undecanoic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 171093333 |
| Molecular Formula | C23H50N4O6 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.37 |
| IUPAC Name | 4-aminobutanamide;11-[[2-(2-ethoxyethoxy)acetyl]amino]undecanoic acid;N-methylmethanamine |
| SMILES | CCOCCOCC(=O)NCCCCCCCCCCC(=O)O.CNC.NCCCC(N)=O |
| InChI | InChI=1S/C17H33NO5.C4H10N2O.C2H7N/c1-2-22-13-14-23-15-16(19)18-12-10-8-6-4-3-5-7-9-11-17(20)21;5-3-1-2-4(6)7;1-3-2/h2-15H2,1H3,(H,18,19)(H,20,21);1-3,5H2,(H2,6,7);3H,1-2H3 |
| InChIKey | OEYHAMOFJUFCGP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|