C9H17NO5 — CID 141090456
5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoic acid (PubChem CID 141090456) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 141090456 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)COCCO |
| InChI | InChI=1S/C9H17NO5/c11-5-6-15-7-8(12)10-4-2-1-3-9(13)14/h11H,1-7H2,(H,10,12)(H,13,14) |
| InChIKey | KAKNENKKZNJXPF-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|