C27H51N3O8 — CID 170598132
11-[[2-[2-[2-(6-carboxyhexanoylamino)ethoxy]ethoxy]acetyl]amino]undecanoic acid;(Z)-prop-1-en-1-amine (PubChem CID 170598132) has the molecular formula C27H51N3O8 and a molecular weight of 545.72 g/mol. Its IUPAC name is 11-[[2-[2-[2-(6-carboxyhexanoylamino)ethoxy]ethoxy]acetyl]amino]undecanoic acid;(Z)-prop-1-en-1-amine.
| Compound Name | 11-[[2-[2-[2-(6-carboxyhexanoylamino)ethoxy]ethoxy]acetyl]amino]undecanoic acid;(Z)-prop-1-en-1-amine |
|---|---|
| PubChem CID | 170598132 |
| Molecular Formula | C27H51N3O8 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | 11-[[2-[2-[2-(6-carboxyhexanoylamino)ethoxy]ethoxy]acetyl]amino]undecanoic acid;(Z)-prop-1-en-1-amine |
| SMILES | C/C=C\N.O=C(O)CCCCCCCCCCNC(=O)COCCOCCNC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C24H44N2O8.C3H7N/c27-21(12-8-7-10-14-24(31)32)26-16-17-33-18-19-34-20-22(28)25-15-11-6-4-2-1-3-5-9-13-23(29)30;1-2-3-4/h1-20H2,(H,25,28)(H,26,27)(H,29,30)(H,31,32);2-3H,4H2,1H3/b;3-2- |
| InChIKey | APYWTPYCDNQAJG-AHNKWOMYSA-N |
| XLogP | 3.36 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|