C23H42BN4O10S — CID 174092481
CID 174092481 (PubChem CID 174092481) has the molecular formula C23H42BN4O10S and a molecular weight of 577.49 g/mol.
| Compound Name | CID 174092481 |
|---|---|
| PubChem CID | 174092481 |
| Molecular Formula | C23H42BN4O10S |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | — |
| SMILES | N[B]SC(=O)CCCCCNC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C23H42BN4O10S/c25-24-39-23(34)7-2-1-3-8-26-20(30)17-37-15-14-36-12-10-28-21(31)18-38-16-13-35-11-9-27-19(29)5-4-6-22(32)33/h1-18,25H2,(H,26,30)(H,27,29)(H,28,31)(H,32,33) |
| InChIKey | DFJSEAHDPDBBLO-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 204.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|