methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate

C10H19NO5 — CID 23125009

IUPACmethyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate
SMILESCOC(=O)CCCCNC(=O)COCCO
InChIInChI=1S/C10H19NO5/c1-15-10(14)4-2-3-5-11-9(13)8-16-7-6-12/h12H,2-8H2,1H3,(H,11,13)
InChIKeyVNYSCRLUJNZUNP-UHFFFAOYSA-N
MW233.26 g/mol
LogP-0.55
Rot. Bonds9

About methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate

methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate (PubChem CID 23125009) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate.

Molecular Properties

Compound Namemethyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate
PubChem CID23125009
Molecular FormulaC10H19NO5
Molecular Weight233.26 g/mol
Exact Mass233.13
IUPAC Namemethyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate
SMILESCOC(=O)CCCCNC(=O)COCCO
InChIInChI=1S/C10H19NO5/c1-15-10(14)4-2-3-5-11-9(13)8-16-7-6-12/h12H,2-8H2,1H3,(H,11,13)
InChIKeyVNYSCRLUJNZUNP-UHFFFAOYSA-N
XLogP-0.55
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.26
LogP ≤ 5-0.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate?
The IUPAC name of methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate (CID 23125009) is methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate.
What is the SMILES notation for methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate?
The canonical SMILES for methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate is COC(=O)CCCCNC(=O)COCCO.
What is the InChIKey of methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate?
The InChIKey is VNYSCRLUJNZUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5/c1-15-10(14)4-2-3-5-11-9(13)8-16-7-6-12/h12H,2-8H2,1H3,(H,11,13).
What are the key properties of methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate?
methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate has a molecular weight of 233.26 g/mol, XLogP of -0.55, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[2-(2-hydroxyethoxy)acetyl]amino]pentanoate is sourced from PubChem (CID 23125009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).