C17H36N4O7 — CID 166896010
2-[2-[2-(ethoxymethyl)-4-[2-(2-hydrazinyl-2-oxoethoxy)ethoxy]-4-methylpentoxy]ethoxy]acetohydrazide (PubChem CID 166896010) has the molecular formula C17H36N4O7 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[2-[2-(ethoxymethyl)-4-[2-(2-hydrazinyl-2-oxoethoxy)ethoxy]-4-methylpentoxy]ethoxy]acetohydrazide.
| Compound Name | 2-[2-[2-(ethoxymethyl)-4-[2-(2-hydrazinyl-2-oxoethoxy)ethoxy]-4-methylpentoxy]ethoxy]acetohydrazide |
|---|---|
| PubChem CID | 166896010 |
| Molecular Formula | C17H36N4O7 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-[2-[2-(ethoxymethyl)-4-[2-(2-hydrazinyl-2-oxoethoxy)ethoxy]-4-methylpentoxy]ethoxy]acetohydrazide |
| SMILES | CCOCC(COCCOCC(=O)NN)CC(C)(C)OCCOCC(=O)NN |
| InChI | InChI=1S/C17H36N4O7/c1-4-24-10-14(11-25-5-6-26-12-15(22)20-18)9-17(2,3)28-8-7-27-13-16(23)21-19/h14H,4-13,18-19H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | CCJFGROATKGBRF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|