C12H25NO4S — CID 175791265
2-[2-(2-ethoxyethoxy)ethoxy]-N-(2-methyl-2-sulfanylpropyl)acetamide (PubChem CID 175791265) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]-N-(2-methyl-2-sulfanylpropyl)acetamide.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]-N-(2-methyl-2-sulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 175791265 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]-N-(2-methyl-2-sulfanylpropyl)acetamide |
| SMILES | CCOCCOCCOCC(=O)NCC(C)(C)S |
| InChI | InChI=1S/C12H25NO4S/c1-4-15-5-6-16-7-8-17-9-11(14)13-10-12(2,3)18/h18H,4-10H2,1-3H3,(H,13,14) |
| InChIKey | RCEIEKUNYZUFIG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|