C27H54N4O14 — CID 143266942
N-[2-[2-[2-(2-hydrazinyl-2-oxoethoxy)-3-[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propoxy]ethoxy]ethyl]-2-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 143266942) has the molecular formula C27H54N4O14 and a molecular weight of 658.74 g/mol. Its IUPAC name is N-[2-[2-[2-(2-hydrazinyl-2-oxoethoxy)-3-[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propoxy]ethoxy]ethyl]-2-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-[2-[2-[2-(2-hydrazinyl-2-oxoethoxy)-3-[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propoxy]ethoxy]ethyl]-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 143266942 |
| Molecular Formula | C27H54N4O14 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | N-[2-[2-[2-(2-hydrazinyl-2-oxoethoxy)-3-[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propoxy]ethoxy]ethyl]-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCOCC(=O)NCCOCCOCC(COCCOCCNC(=O)COCCOCCOC)OCC(=O)NN |
| InChI | InChI=1S/C27H54N4O14/c1-35-7-9-39-13-17-43-21-25(32)29-3-5-37-11-15-41-19-24(45-23-27(34)31-28)20-42-16-12-38-6-4-30-26(33)22-44-18-14-40-10-8-36-2/h24H,3-23,28H2,1-2H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | DRFNECVBAKPXGD-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 214.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|