C30H57N3O16 — CID 91243762
3-[[2-[1,3-bis[2-[2-[[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]ethylidene]amino]ethoxy]ethoxy]propan-2-yloxy]acetyl]amino]propanoic acid (PubChem CID 91243762) has the molecular formula C30H57N3O16 and a molecular weight of 715.79 g/mol. Its IUPAC name is 3-[[2-[1,3-bis[2-[2-[[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]ethylidene]amino]ethoxy]ethoxy]propan-2-yloxy]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[1,3-bis[2-[2-[[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]ethylidene]amino]ethoxy]ethoxy]propan-2-yloxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91243762 |
| Molecular Formula | C30H57N3O16 |
| Molecular Weight | 715.79 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | 3-[[2-[1,3-bis[2-[2-[[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]ethylidene]amino]ethoxy]ethoxy]propan-2-yloxy]acetyl]amino]propanoic acid |
| SMILES | COCCOCCO/C(CO)=N/CCOCCOCC(COCCOCC/N=C(\CO)OCCOCCOC)OCC(=O)NCCC(=O)O |
| InChI | InChI=1S/C30H57N3O16/c1-39-9-11-43-17-19-47-28(21-34)32-5-7-41-13-15-45-23-26(49-25-27(36)31-4-3-30(37)38)24-46-16-14-42-8-6-33-29(22-35)48-20-18-44-12-10-40-2/h26,34-35H,3-25H2,1-2H3,(H,31,36)(H,37,38)/b32-28+,33-29+ |
| InChIKey | HXRIMASTRZJVHK-NUOLXNBNSA-N |
| XLogP | -1.83 |
| TPSA | 233.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.79 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|