C16H33N3O8 — CID 91357782
3-[[2-[1,3-bis[2-(2-aminoethoxy)ethoxy]propoxy]acetyl]amino]propanoic acid (PubChem CID 91357782) has the molecular formula C16H33N3O8 and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-[[2-[1,3-bis[2-(2-aminoethoxy)ethoxy]propoxy]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[1,3-bis[2-(2-aminoethoxy)ethoxy]propoxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91357782 |
| Molecular Formula | C16H33N3O8 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-[[2-[1,3-bis[2-(2-aminoethoxy)ethoxy]propoxy]acetyl]amino]propanoic acid |
| SMILES | NCCOCCOCCC(OCCOCCN)OCC(=O)NCCC(=O)O |
| InChI | InChI=1S/C16H33N3O8/c17-3-7-24-10-9-23-6-2-16(26-12-11-25-8-4-18)27-13-14(20)19-5-1-15(21)22/h16H,1-13,17-18H2,(H,19,20)(H,21,22) |
| InChIKey | BXBCRWCLXROWFL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 164.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|