C12H24N2O7 — CID 141122061
2-amino-2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetic acid (PubChem CID 141122061) has the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-amino-2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-amino-2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 141122061 |
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-amino-2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetic acid |
| SMILES | CCOCCOCCOCCNC(=O)COC(N)C(=O)O |
| InChI | InChI=1S/C12H24N2O7/c1-2-18-5-6-20-8-7-19-4-3-14-10(15)9-21-11(13)12(16)17/h11H,2-9,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | AYWUQRBCCGCRLA-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|