C13H28N4O5 — CID 123372853
N-(2-methoxyethyl)-2-[2-[2-[2-(methylamino)ethylcarbamoylamino]ethoxy]ethoxy]acetamide (PubChem CID 123372853) has the molecular formula C13H28N4O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[2-[2-[2-(methylamino)ethylcarbamoylamino]ethoxy]ethoxy]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[2-[2-[2-(methylamino)ethylcarbamoylamino]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 123372853 |
| Molecular Formula | C13H28N4O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-(2-methoxyethyl)-2-[2-[2-[2-(methylamino)ethylcarbamoylamino]ethoxy]ethoxy]acetamide |
| SMILES | CNCCNC(=O)NCCOCCOCC(=O)NCCOC |
| InChI | InChI=1S/C13H28N4O5/c1-14-3-4-16-13(19)17-6-8-21-9-10-22-11-12(18)15-5-7-20-2/h14H,3-11H2,1-2H3,(H,15,18)(H2,16,17,19) |
| InChIKey | XJWUXLDIOOVDRL-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|