C19H48N2O3 — CID 153398683
ethane;3-(4-methoxybutoxy)-N-[2-(methylamino)ethyl]propanamide (PubChem CID 153398683) has the molecular formula C19H48N2O3 and a molecular weight of 352.60 g/mol. Its IUPAC name is ethane;3-(4-methoxybutoxy)-N-[2-(methylamino)ethyl]propanamide.
| Compound Name | ethane;3-(4-methoxybutoxy)-N-[2-(methylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 153398683 |
| Molecular Formula | C19H48N2O3 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | ethane;3-(4-methoxybutoxy)-N-[2-(methylamino)ethyl]propanamide |
| SMILES | CC.CC.CC.CC.CNCCNC(=O)CCOCCCCOC |
| InChI | InChI=1S/C11H24N2O3.4C2H6/c1-12-6-7-13-11(14)5-10-16-9-4-3-8-15-2;4*1-2/h12H,3-10H2,1-2H3,(H,13,14);4*1-2H3 |
| InChIKey | MYJZHCVXHPWUEZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|