C10H21NO4 — CID 104578556
2-(2-methoxyethoxy)-N-(2-propan-2-yloxyethyl)acetamide (PubChem CID 104578556) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(2-propan-2-yloxyethyl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(2-propan-2-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 104578556 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(2-propan-2-yloxyethyl)acetamide |
| SMILES | COCCOCC(=O)NCCOC(C)C |
| InChI | InChI=1S/C10H21NO4/c1-9(2)15-5-4-11-10(12)8-14-7-6-13-3/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | KYFKLVNLDAIULD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|