C12H26N2O3 — CID 103614127
2-(2-methoxyethoxy)-N-[3-[methyl(propan-2-yl)amino]propyl]acetamide (PubChem CID 103614127) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[3-[methyl(propan-2-yl)amino]propyl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[3-[methyl(propan-2-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 103614127 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[3-[methyl(propan-2-yl)amino]propyl]acetamide |
| SMILES | COCCOCC(=O)NCCCN(C)C(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-11(2)14(3)7-5-6-13-12(15)10-17-9-8-16-4/h11H,5-10H2,1-4H3,(H,13,15) |
| InChIKey | UJMOVYHZBASCRG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|