C26H52N2O8S2 — CID 15499688
2-[2-(2-methoxyethoxy)ethoxy]-N-[6-[6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexyldisulfanyl]hexyl]acetamide (PubChem CID 15499688) has the molecular formula C26H52N2O8S2 and a molecular weight of 584.84 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-N-[6-[6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexyldisulfanyl]hexyl]acetamide.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-N-[6-[6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexyldisulfanyl]hexyl]acetamide |
|---|---|
| PubChem CID | 15499688 |
| Molecular Formula | C26H52N2O8S2 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-N-[6-[6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexyldisulfanyl]hexyl]acetamide |
| SMILES | COCCOCCOCC(=O)NCCCCCCSSCCCCCCNC(=O)COCCOCCOC |
| InChI | InChI=1S/C26H52N2O8S2/c1-31-13-15-33-17-19-35-23-25(29)27-11-7-3-5-9-21-37-38-22-10-6-4-8-12-28-26(30)24-36-20-18-34-16-14-32-2/h3-24H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | MFLVBYHOJOPYFX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|