C15H32N2O5S — CID 176734991
2-[2-[methyl(propan-2-yl)amino]ethoxy]-N-[2-(2-propan-2-ylsulfonylethoxy)ethyl]acetamide (PubChem CID 176734991) has the molecular formula C15H32N2O5S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[2-[methyl(propan-2-yl)amino]ethoxy]-N-[2-(2-propan-2-ylsulfonylethoxy)ethyl]acetamide.
| Compound Name | 2-[2-[methyl(propan-2-yl)amino]ethoxy]-N-[2-(2-propan-2-ylsulfonylethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 176734991 |
| Molecular Formula | C15H32N2O5S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[2-[methyl(propan-2-yl)amino]ethoxy]-N-[2-(2-propan-2-ylsulfonylethoxy)ethyl]acetamide |
| SMILES | CC(C)N(C)CCOCC(=O)NCCOCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C15H32N2O5S/c1-13(2)17(5)7-9-22-12-15(18)16-6-8-21-10-11-23(19,20)14(3)4/h13-14H,6-12H2,1-5H3,(H,16,18) |
| InChIKey | LSAXPBYWONZLTE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|