C12H26N2O4S — CID 110612720
N-[2-[2-(diethylamino)ethoxy]ethyl]-3-methylsulfonylpropanamide (PubChem CID 110612720) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]ethyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110612720 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-3-methylsulfonylpropanamide |
| SMILES | CCN(CC)CCOCCNC(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O4S/c1-4-14(5-2)8-10-18-9-7-13-12(15)6-11-19(3,16)17/h4-11H2,1-3H3,(H,13,15) |
| InChIKey | IKBODIHDHSALAG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|