C15H31NO7S — CID 177226030
N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methylsulfonylpentanamide (PubChem CID 177226030) has the molecular formula C15H31NO7S and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methylsulfonylpentanamide.
| Compound Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 177226030 |
| Molecular Formula | C15H31NO7S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-5-methylsulfonylpentanamide |
| SMILES | COCCOCCOCCOCCNC(=O)CCCCS(C)(=O)=O |
| InChI | InChI=1S/C15H31NO7S/c1-20-8-9-22-12-13-23-11-10-21-7-6-16-15(17)5-3-4-14-24(2,18)19/h3-14H2,1-2H3,(H,16,17) |
| InChIKey | QHWYBVWLSZRESB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|