C13H27NO3S2 — CID 102100758
N-[2-(2-methoxyethoxy)ethyl]-6,8-bis(sulfanyl)octanamide (PubChem CID 102100758) has the molecular formula C13H27NO3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-6,8-bis(sulfanyl)octanamide.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-6,8-bis(sulfanyl)octanamide |
|---|---|
| PubChem CID | 102100758 |
| Molecular Formula | C13H27NO3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-6,8-bis(sulfanyl)octanamide |
| SMILES | COCCOCCNC(=O)CCCCC(S)CCS |
| InChI | InChI=1S/C13H27NO3S2/c1-16-9-10-17-8-7-14-13(15)5-3-2-4-12(19)6-11-18/h12,18-19H,2-11H2,1H3,(H,14,15) |
| InChIKey | IWAUYTLNHBXQTH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|