C25H50N2O6S — CID 101252962
N-[4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoylamino]butyl]-11-sulfanylundecanamide (PubChem CID 101252962) has the molecular formula C25H50N2O6S and a molecular weight of 506.75 g/mol. Its IUPAC name is N-[4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoylamino]butyl]-11-sulfanylundecanamide.
| Compound Name | N-[4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoylamino]butyl]-11-sulfanylundecanamide |
|---|---|
| PubChem CID | 101252962 |
| Molecular Formula | C25H50N2O6S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | N-[4-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoylamino]butyl]-11-sulfanylundecanamide |
| SMILES | COCCOCCOCCOCCC(=O)NCCCCNC(=O)CCCCCCCCCCS |
| InChI | InChI=1S/C25H50N2O6S/c1-30-17-18-32-21-22-33-20-19-31-16-13-25(29)27-15-10-9-14-26-24(28)12-8-6-4-2-3-5-7-11-23-34/h34H,2-23H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | WALIFTYPQRMAQY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|