C15H31N3O5S — CID 110618498
N-[2-[2-(diethylamino)ethoxy]ethyl]-3-morpholin-4-ylsulfonylpropanamide (PubChem CID 110618498) has the molecular formula C15H31N3O5S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]ethyl]-3-morpholin-4-ylsulfonylpropanamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-3-morpholin-4-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 110618498 |
| Molecular Formula | C15H31N3O5S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]ethyl]-3-morpholin-4-ylsulfonylpropanamide |
| SMILES | CCN(CC)CCOCCNC(=O)CCS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H31N3O5S/c1-3-17(4-2)7-11-22-10-6-16-15(19)5-14-24(20,21)18-8-12-23-13-9-18/h3-14H2,1-2H3,(H,16,19) |
| InChIKey | FGWNNUMGIXLPML-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|