C11H20N2O7S — CID 79469301
2-[2-(3-morpholin-4-ylsulfonylpropanoylamino)ethoxy]acetic acid (PubChem CID 79469301) has the molecular formula C11H20N2O7S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[2-(3-morpholin-4-ylsulfonylpropanoylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(3-morpholin-4-ylsulfonylpropanoylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79469301 |
| Molecular Formula | C11H20N2O7S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[2-(3-morpholin-4-ylsulfonylpropanoylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)CCS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H20N2O7S/c14-10(12-2-5-20-9-11(15)16)1-8-21(17,18)13-3-6-19-7-4-13/h1-9H2,(H,12,14)(H,15,16) |
| InChIKey | PWRGAEKQHLNYFL-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|