C11H21N3O5 — CID 79463716
2-[2-(2-morpholin-4-ylethylcarbamoylamino)ethoxy]acetic acid (PubChem CID 79463716) has the molecular formula C11H21N3O5 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[2-(2-morpholin-4-ylethylcarbamoylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(2-morpholin-4-ylethylcarbamoylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463716 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[2-(2-morpholin-4-ylethylcarbamoylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C11H21N3O5/c15-10(16)9-19-6-2-13-11(17)12-1-3-14-4-7-18-8-5-14/h1-9H2,(H,15,16)(H2,12,13,17) |
| InChIKey | KMVGQUBEIYUBKH-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|