C12H19N3O5 — CID 100926424
2-[[(E)-4-(2-morpholin-4-ylethylamino)-4-oxobut-2-enoyl]amino]acetic acid (PubChem CID 100926424) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[[(E)-4-(2-morpholin-4-ylethylamino)-4-oxobut-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(E)-4-(2-morpholin-4-ylethylamino)-4-oxobut-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 100926424 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[[(E)-4-(2-morpholin-4-ylethylamino)-4-oxobut-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)/C=C/C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C12H19N3O5/c16-10(1-2-11(17)14-9-12(18)19)13-3-4-15-5-7-20-8-6-15/h1-2H,3-9H2,(H,13,16)(H,14,17)(H,18,19)/b2-1+ |
| InChIKey | QNZMKIBLZURQOK-OWOJBTEDSA-N |
| XLogP | -1.81 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|