2-morpholin-4-ylethylhydrazine;oxalic acid

C10H19N3O9 — CID 46741446

IUPAC2-morpholin-4-ylethylhydrazine;oxalic acid
SMILESNNCCN1CCOCC1.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C6H15N3O.2C2H2O4/c7-8-1-2-9-3-5-10-6-4-9;2*3-1(4)2(5)6/h8H,1-7H2;2*(H,3,4)(H,5,6)
InChIKeyTXYXYWIPXBYMMD-UHFFFAOYSA-N
MW325.27 g/mol
LogP-2.91
Rot. Bonds3

About 2-morpholin-4-ylethylhydrazine;oxalic acid

2-morpholin-4-ylethylhydrazine;oxalic acid (PubChem CID 46741446) has the molecular formula C10H19N3O9 and a molecular weight of 325.27 g/mol. Its IUPAC name is 2-morpholin-4-ylethylhydrazine;oxalic acid.

Molecular Properties

Compound Name2-morpholin-4-ylethylhydrazine;oxalic acid
PubChem CID46741446
Molecular FormulaC10H19N3O9
Molecular Weight325.27 g/mol
Exact Mass325.11
IUPAC Name2-morpholin-4-ylethylhydrazine;oxalic acid
SMILESNNCCN1CCOCC1.O=C(O)C(=O)O.O=C(O)C(=O)O
InChIInChI=1S/C6H15N3O.2C2H2O4/c7-8-1-2-9-3-5-10-6-4-9;2*3-1(4)2(5)6/h8H,1-7H2;2*(H,3,4)(H,5,6)
InChIKeyTXYXYWIPXBYMMD-UHFFFAOYSA-N
XLogP-2.91
TPSA199.72 Ų
H-Bond Donors6
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500325.27
LogP ≤ 5-2.91
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-morpholin-4-ylethylhydrazine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-morpholin-4-ylethylhydrazine;oxalic acid?
The IUPAC name of 2-morpholin-4-ylethylhydrazine;oxalic acid (CID 46741446) is 2-morpholin-4-ylethylhydrazine;oxalic acid.
What is the SMILES notation for 2-morpholin-4-ylethylhydrazine;oxalic acid?
The canonical SMILES for 2-morpholin-4-ylethylhydrazine;oxalic acid is NNCCN1CCOCC1.O=C(O)C(=O)O.O=C(O)C(=O)O.
What is the InChIKey of 2-morpholin-4-ylethylhydrazine;oxalic acid?
The InChIKey is TXYXYWIPXBYMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O.2C2H2O4/c7-8-1-2-9-3-5-10-6-4-9;2*3-1(4)2(5)6/h8H,1-7H2;2*(H,3,4)(H,5,6).
What are the key properties of 2-morpholin-4-ylethylhydrazine;oxalic acid?
2-morpholin-4-ylethylhydrazine;oxalic acid has a molecular weight of 325.27 g/mol, XLogP of -2.91, 3 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethylhydrazine;oxalic acid is sourced from PubChem (CID 46741446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).