C26H52N6O8 — CID 134229716
bis((2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide);oxalic acid (PubChem CID 134229716) has the molecular formula C26H52N6O8 and a molecular weight of 576.74 g/mol. Its IUPAC name is bis((2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide);oxalic acid.
| Compound Name | bis((2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide);oxalic acid |
|---|---|
| PubChem CID | 134229716 |
| Molecular Formula | C26H52N6O8 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | bis((2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide);oxalic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCCN1CCOCC1.CC[C@H](C)[C@H](N)C(=O)NCCN1CCOCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C12H25N3O2.C2H2O4/c2*1-3-10(2)11(13)12(16)14-4-5-15-6-8-17-9-7-15;3-1(4)2(5)6/h2*10-11H,3-9,13H2,1-2H3,(H,14,16);(H,3,4)(H,5,6)/t2*10-,11-;/m00./s1 |
| InChIKey | MYTZGALLVLKRGN-XTQNZXNBSA-N |
| XLogP | -1.23 |
| TPSA | 209.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|