C12H29N3O10S2 — CID 67172232
(2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid (PubChem CID 67172232) has the molecular formula C12H29N3O10S2 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid |
|---|---|
| PubChem CID | 67172232 |
| Molecular Formula | C12H29N3O10S2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCCN1CCOCC1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H25N3O2.2H2O4S/c1-3-10(2)11(13)12(16)14-4-5-15-6-8-17-9-7-15;2*1-5(2,3)4/h10-11H,3-9,13H2,1-2H3,(H,14,16);2*(H2,1,2,3,4)/t10-,11-;;/m0../s1 |
| InChIKey | ZIFQVCFCJSYIQF-ULEGLUPFSA-N |
| XLogP | -1.50 |
| TPSA | 216.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|