C12H25N3O2 — CID 91971542
(2S,3S)-2-amino-3-methyl-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]pentanamide (PubChem CID 91971542) has the molecular formula C12H25N3O2 and a molecular weight of 251.40 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 91971542 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethyl]pentanamide |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(CCNC(=O)[C@@H](N)[C@@H](C)CC)C1([2H])[2H] |
| InChI | InChI=1S/C12H25N3O2/c1-3-10(2)11(13)12(16)14-4-5-15-6-8-17-9-7-15/h10-11H,3-9,13H2,1-2H3,(H,14,16)/t10-,11-/m0/s1/i6D2,7D2,8D2,9D2 |
| InChIKey | YNMUTYLWSRFTPX-VACLCWEGSA-N |
| XLogP | -0.19 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |