C11H24N2O6S — CID 162122494
N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid (PubChem CID 162122494) has the molecular formula C11H24N2O6S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid.
| Compound Name | N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid |
|---|---|
| PubChem CID | 162122494 |
| Molecular Formula | C11H24N2O6S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)pentanamide;sulfuric acid |
| SMILES | CCCCC(=O)NCCN1CCOCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C11H22N2O2.H2O4S/c1-2-3-4-11(14)12-5-6-13-7-9-15-10-8-13;1-5(2,3)4/h2-10H2,1H3,(H,12,14);(H2,1,2,3,4) |
| InChIKey | ZHPFMSLLEPSOEJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|