C14H29N3O4S — CID 113153386
2-[methylsulfonyl(pentyl)amino]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 113153386) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[methylsulfonyl(pentyl)amino]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[methylsulfonyl(pentyl)amino]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 113153386 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[methylsulfonyl(pentyl)amino]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCCCCN(CC(=O)NCCN1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H29N3O4S/c1-3-4-5-7-17(22(2,19)20)13-14(18)15-6-8-16-9-11-21-12-10-16/h3-13H2,1-2H3,(H,15,18) |
| InChIKey | YYFYPMDAILLVRD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|