C16H31N3O3 — CID 108960403
2,2-dimethyl-N-(2-morpholin-4-ylethyl)-N'-pentylpropanediamide (PubChem CID 108960403) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-morpholin-4-ylethyl)-N'-pentylpropanediamide.
| Compound Name | 2,2-dimethyl-N-(2-morpholin-4-ylethyl)-N'-pentylpropanediamide |
|---|---|
| PubChem CID | 108960403 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 2,2-dimethyl-N-(2-morpholin-4-ylethyl)-N'-pentylpropanediamide |
| SMILES | CCCCCNC(=O)C(C)(C)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H31N3O3/c1-4-5-6-7-17-14(20)16(2,3)15(21)18-8-9-19-10-12-22-13-11-19/h4-13H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | FRHRPFUKZVVQKK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|