C10H18Cl2N2O2 — CID 7375443
(2S)-2,3-dichloro-2-methyl-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 7375443) has the molecular formula C10H18Cl2N2O2 and a molecular weight of 269.17 g/mol. Its IUPAC name is (2S)-2,3-dichloro-2-methyl-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | (2S)-2,3-dichloro-2-methyl-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 7375443 |
| Molecular Formula | C10H18Cl2N2O2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2S)-2,3-dichloro-2-methyl-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | C[C@@](Cl)(CCl)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C10H18Cl2N2O2/c1-10(12,8-11)9(15)13-2-3-14-4-6-16-7-5-14/h2-8H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | NWDLVSIZGIYNIO-SNVBAGLBSA-N |
| XLogP | 0.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|