C8H13Cl3N2O2 — CID 3533686
2,2,2-trichloro-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 3533686) has the molecular formula C8H13Cl3N2O2 and a molecular weight of 275.56 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 3533686 |
| Molecular Formula | C8H13Cl3N2O2 |
| Molecular Weight | 275.56 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2,2,2-trichloro-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(NCCN1CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3N2O2/c9-8(10,11)7(14)12-1-2-13-3-5-15-6-4-13/h1-6H2,(H,12,14) |
| InChIKey | SXANUZDUHWFMNM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.56 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|