C13H15F11N2O2 — CID 58855436
2,2,3,3,4,4,5,5,7,7,7-undecafluoro-N-(2-morpholin-4-ylethyl)heptanamide (PubChem CID 58855436) has the molecular formula C13H15F11N2O2 and a molecular weight of 440.25 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,7,7,7-undecafluoro-N-(2-morpholin-4-ylethyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,7,7,7-undecafluoro-N-(2-morpholin-4-ylethyl)heptanamide |
|---|---|
| PubChem CID | 58855436 |
| Molecular Formula | C13H15F11N2O2 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,7,7,7-undecafluoro-N-(2-morpholin-4-ylethyl)heptanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C13H15F11N2O2/c14-9(15,7-10(16,17)18)12(21,22)13(23,24)11(19,20)8(27)25-1-2-26-3-5-28-6-4-26/h1-7H2,(H,25,27) |
| InChIKey | LWYMEMNAGVBVJO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|