C9H13F5N2OS — CID 114174018
2,2,3,3,3-pentafluoro-N-(2-thiomorpholin-4-ylethyl)propanamide (PubChem CID 114174018) has the molecular formula C9H13F5N2OS and a molecular weight of 292.27 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(2-thiomorpholin-4-ylethyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(2-thiomorpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 114174018 |
| Molecular Formula | C9H13F5N2OS |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(2-thiomorpholin-4-ylethyl)propanamide |
| SMILES | O=C(NCCN1CCSCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5N2OS/c10-8(11,9(12,13)14)7(17)15-1-2-16-3-5-18-6-4-16/h1-6H2,(H,15,17) |
| InChIKey | LNZSLUAVQSPEMX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|