C10H21N3OS — CID 103813710
(2S)-2-amino-N-(2-thiomorpholin-4-ylethyl)butanamide (PubChem CID 103813710) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-thiomorpholin-4-ylethyl)butanamide.
| Compound Name | (2S)-2-amino-N-(2-thiomorpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 103813710 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (2S)-2-amino-N-(2-thiomorpholin-4-ylethyl)butanamide |
| SMILES | CC[C@H](N)C(=O)NCCN1CCSCC1 |
| InChI | InChI=1S/C10H21N3OS/c1-2-9(11)10(14)12-3-4-13-5-7-15-8-6-13/h9H,2-8,11H2,1H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | VUBYVIBKQIJDKL-VIFPVBQESA-N |
| XLogP | -0.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |