C17H31Cl3N4O — CID 119900995
(2S)-2-amino-N-[2-(4-benzylpiperazin-1-yl)ethyl]butanamide;trihydrochloride (PubChem CID 119900995) has the molecular formula C17H31Cl3N4O and a molecular weight of 413.82 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(4-benzylpiperazin-1-yl)ethyl]butanamide;trihydrochloride.
| Compound Name | (2S)-2-amino-N-[2-(4-benzylpiperazin-1-yl)ethyl]butanamide;trihydrochloride |
|---|---|
| PubChem CID | 119900995 |
| Molecular Formula | C17H31Cl3N4O |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2S)-2-amino-N-[2-(4-benzylpiperazin-1-yl)ethyl]butanamide;trihydrochloride |
| SMILES | CC[C@H](N)C(=O)NCCN1CCN(Cc2ccccc2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C17H28N4O.3ClH/c1-2-16(18)17(22)19-8-9-20-10-12-21(13-11-20)14-15-6-4-3-5-7-15;;;/h3-7,16H,2,8-14,18H2,1H3,(H,19,22);3*1H/t16-;;;/m0.../s1 |
| InChIKey | BYQVOQZVFNWMKJ-OKUPDQQSSA-N |
| XLogP | 1.92 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |