C17H28N4O2 — CID 110892815
1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(1-hydroxypropan-2-yl)urea (PubChem CID 110892815) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(1-hydroxypropan-2-yl)urea.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 110892815 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)NC(=O)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-15(14-22)19-17(23)18-7-8-20-9-11-21(12-10-20)13-16-5-3-2-4-6-16/h2-6,15,22H,7-14H2,1H3,(H2,18,19,23) |
| InChIKey | YJZHPYCHDCMDFD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |