C21H28N4O3 — CID 134015009
N-[1-[2-(4-benzylpiperazin-1-yl)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 134015009) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[1-[2-(4-benzylpiperazin-1-yl)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[2-(4-benzylpiperazin-1-yl)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134015009 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[1-[2-(4-benzylpiperazin-1-yl)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)C(=O)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-17(23-21(27)19-8-5-15-28-19)20(26)22-9-10-24-11-13-25(14-12-24)16-18-6-3-2-4-7-18/h2-8,15,17H,9-14,16H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | QBFUVYGTDBQJHE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |