C24H28N4O3S — CID 39983594
N-[5-[2-(4-benzylpiperazin-1-yl)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 39983594) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[5-[2-(4-benzylpiperazin-1-yl)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-(4-benzylpiperazin-1-yl)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39983594 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[5-[2-(4-benzylpiperazin-1-yl)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N4O3S/c1-18-16-21(26-23(29)20-8-5-15-31-20)32-22(18)24(30)25-9-10-27-11-13-28(14-12-27)17-19-6-3-2-4-7-19/h2-8,15-16H,9-14,17H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | SUUDQHIXLNNQNA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |