C15H20ClN3O3S — CID 119506646
N-[5-[2-(ethylamino)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide;hydrochloride (PubChem CID 119506646) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is N-[5-[2-(ethylamino)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[5-[2-(ethylamino)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119506646 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[5-[2-(ethylamino)ethylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1sc(NC(=O)c2ccco2)cc1C.Cl |
| InChI | InChI=1S/C15H19N3O3S.ClH/c1-3-16-6-7-17-15(20)13-10(2)9-12(22-13)18-14(19)11-5-4-8-21-11;/h4-5,8-9,16H,3,6-7H2,1-2H3,(H,17,20)(H,18,19);1H |
| InChIKey | YKEVWZNDZAGAQG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|