C14H21N3OS — CID 103813654
2-amino-2-phenyl-N-(2-thiomorpholin-4-ylethyl)acetamide (PubChem CID 103813654) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-amino-2-phenyl-N-(2-thiomorpholin-4-ylethyl)acetamide.
| Compound Name | 2-amino-2-phenyl-N-(2-thiomorpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 103813654 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-amino-2-phenyl-N-(2-thiomorpholin-4-ylethyl)acetamide |
| SMILES | NC(C(=O)NCCN1CCSCC1)c1ccccc1 |
| InChI | InChI=1S/C14H21N3OS/c15-13(12-4-2-1-3-5-12)14(18)16-6-7-17-8-10-19-11-9-17/h1-5,13H,6-11,15H2,(H,16,18) |
| InChIKey | LPCAADOADXSKNF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |