C21H26N2OS — CID 58938041
N-(3,3-diphenylpropyl)-2-thiomorpholin-4-ylacetamide (PubChem CID 58938041) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2-thiomorpholin-4-ylacetamide.
| Compound Name | N-(3,3-diphenylpropyl)-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 58938041 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2-thiomorpholin-4-ylacetamide |
| SMILES | O=C(CN1CCSCC1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2OS/c24-21(17-23-13-15-25-16-14-23)22-12-11-20(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,20H,11-17H2,(H,22,24) |
| InChIKey | FRHDTZZEQSZFEK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |