C25H28N2O3 — CID 7935615
2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3,3-diphenylpropyl)acetamide (PubChem CID 7935615) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3,3-diphenylpropyl)acetamide.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3,3-diphenylpropyl)acetamide |
|---|---|
| PubChem CID | 7935615 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3,3-diphenylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@H]2C1=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O3/c28-23(17-27-24(29)21-13-7-8-14-22(21)25(27)30)26-16-15-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,20-22H,7-8,13-17H2,(H,26,28)/t21-,22+ |
| InChIKey | LFFQINWUVUAKKM-SZPZYZBQSA-N |
| XLogP | 3.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|