C18H22N4O5 — CID 9278370
2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2-nitroanilino)ethyl]acetamide (PubChem CID 9278370) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 9278370 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2-nitroanilino)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@H]2C1=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5/c23-16(11-21-17(24)12-5-1-2-6-13(12)18(21)25)20-10-9-19-14-7-3-4-8-15(14)22(26)27/h3-4,7-8,12-13,19H,1-2,5-6,9-11H2,(H,20,23)/t12-,13+ |
| InChIKey | FVZOUUSAPVKYPV-BETUJISGSA-N |
| XLogP | 1.30 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|