C22H31N5O5 — CID 55519006
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide (PubChem CID 55519006) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 55519006 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NCCNc1ccccc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C22H31N5O5/c1-21(2,3)15-8-10-22(11-9-15)19(29)26(20(30)25-22)14-18(28)24-13-12-23-16-6-4-5-7-17(16)27(31)32/h4-7,15,23H,8-14H2,1-3H3,(H,24,28)(H,25,30) |
| InChIKey | CCEXCEGXXJHHEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|