C22H30F3N5O3 — CID 46423191
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 46423191) has the molecular formula C22H30F3N5O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 46423191 |
| Molecular Formula | C22H30F3N5O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NCCNc1ccc(C(F)(F)F)cn1)C2=O |
| InChI | InChI=1S/C22H30F3N5O3/c1-20(2,3)14-6-8-21(9-7-14)18(32)30(19(33)29-21)13-17(31)27-11-10-26-16-5-4-15(12-28-16)22(23,24)25/h4-5,12,14H,6-11,13H2,1-3H3,(H,26,28)(H,27,31)(H,29,33) |
| InChIKey | LMABNLXYUMPPRT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|