C24H34N4O5S — CID 55972396
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]acetamide (PubChem CID 55972396) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55972396 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]acetamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccc(S(=O)(=O)NC3CC3)cc1)C2=O |
| InChI | InChI=1S/C24H34N4O5S/c1-23(2,3)17-10-12-24(13-11-17)21(30)28(22(31)26-24)15-20(29)25-14-16-4-8-19(9-5-16)34(32,33)27-18-6-7-18/h4-5,8-9,17-18,27H,6-7,10-15H2,1-3H3,(H,25,29)(H,26,31) |
| InChIKey | LJOHADXJWUPKJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|